DB00605 Sulindac
InChI Key: MLKXDPUZXIRXEP-MFOYZWKCSA-N
SMILES: CC1=C(CC(O)=O)C2=CC(F)=CC=C2\C1=C/C1=CC=C(C=C1)S(C)=O
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein O60218
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| O60218 | Download | Predicted | O60218_nD1 | TIM beta/alpha-barrel | |
| 1ZUA | Predicted | e1zuaX1 | |||
| 4GA8 | Predicted | e4ga8A1 | |||
| 4GAB | Predicted | e4gabA1 | |||
| 4GQ0 | Predicted | e4gq0A1 | |||
| 4GQG | Predicted | e4gqgA1 | |||
| 4I5X | Predicted | e4i5xA1 | |||
| 4ICC | Predicted | e4iccX1 | |||
| 4JIH | Predicted | e4jihA1 | |||
| 4JII | Predicted | e4jiiX1 | |||
| 4WEV | Predicted | e4wevX1 | |||
| 4XZL | Predicted | e4xzlX1 | |||
| 4XZM | Predicted | e4xzmX1 | |||
| 4XZN | Predicted | e4xznX1 | |||
| 5LIK | Predicted | e5likX1 | |||
| 5LIU | Predicted | e5liuX1 | |||
| 5LIW | Predicted | e5liwX1 | |||
| 5LIX | Predicted | e5lixX1 | |||
| 5LIY | Predicted | e5liyX1 | |||
| 5M2F | Predicted | e5m2fX1 | |||
| 5Y7N | Predicted | e5y7nA1 |