DB00126 Ascorbic acid
InChI Key: CIWBSHSKHKDKBQ-JLAZNSOCSA-N
SMILES: [H][C@@]1(OC(=O)C(O)=C1O)[C@@H](O)CO
Small molecule PDB accession : ASC
Drug action: cofactor
List of PDB structures and/or AlphaFold models with target protein O60568
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| O60568 | Download | Predicted | O60568_nD3 O60568_nD1 | jelly-roll Nucleotide-diphospho-sugar transferases | |
| 6FXK | Predicted | e6fxkA1 | |||
| 6FXM | Predicted | e6fxmA1 | |||
| 6FXR | Predicted | e6fxrA1 | |||
| 6FXT | Predicted | e6fxtA2 | |||
| 6FXX | Predicted | e6fxxA1 | |||
| 6FXY | Predicted | e6fxyA2 |