DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein O75460
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| O75460 | Download | Predicted | O75460_nD4 O75460_nD3 | Four-helical up-and-down bundle Protein kinase/SAICAR synthase/ATP-grasp | |
| 2HZ6 | Predicted | e2hz6A1 | |||
| 3P23 | Predicted | e3p23D2 e3p23B2 e3p23A2 e3p23C2 e3p23D1 e3p23B1 e3p23A1 e3p23C1 | |||
| 4U6R | Predicted | e4u6rA2 e4u6rA1 | |||
| 4YZ9 | Predicted | e4yz9A2 e4yz9B2 e4yz9C1 e4yz9A1 e4yz9C2 e4yz9B1 | |||
| 4YZC | Predicted | e4yzcA1 e4yzcB2 e4yzcA2 e4yzcB1 | |||
| 4YZD | Predicted | e4yzdA2 e4yzdB1 e4yzdC1 e4yzdA1 e4yzdC2 e4yzdB2 | |||
| 4Z7G | Predicted | e4z7gA2 e4z7gB1 e4z7gB2 e4z7gA1 | |||
| 4Z7H | Predicted | e4z7hA1 e4z7hB1 e4z7hA2 e4z7hB2 | |||
| 5HGI | Predicted | e5hgiA2 e5hgiA1 | |||
| 6HV0 | Predicted | e6hv0A2 e6hv0A1 | |||
| 6HX1 | Predicted | e6hx1A1 e6hx1A2 | |||
| 6SHC | Predicted | e6shcA1 | |||
| 6URC | Predicted | e6urcA1 e6urcB1 e6urcA2 e6urcB2 |