DB05928 Dovitinib
InChI Key: PIQCTGMSNWUMAF-UHFFFAOYSA-N
SMILES: CN1CCN(CC1)C1=CC=C2N=C(NC2=C1)C1=C(N)C2=C(NC1=O)C=CC=C2F
Small molecule PDB accession : 38O
Drug action: suppressor
List of PDB structures and/or AlphaFold models with target protein O75469
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| O75469 | Download | Predicted | O75469_nD2 O75469_nD1 | Nuclear receptor ligand-binding domain Glucocorticoid receptor-like | |
| 1ILG | Predicted | e1ilgA1 | |||
| 1ILH | Predicted | e1ilhA1 | |||
| 1M13 | Predicted | e1m13A1 | |||
| 1NRL | Predicted | e1nrlA1 e1nrlB1 | |||
| 1SKX | Predicted | e1skxA1 | |||
| 2O9I | Predicted | e2o9iA1 e2o9iB1 | |||
| 2QNV | Predicted | e2qnvA1 | |||
| 3HVL | Predicted | e3hvlA1 e3hvlB1 | |||
| 3R8D | Predicted | e3r8dA1 | |||
| 4J5W | Predicted | e4j5wA1 e4j5wB1 | |||
| 4J5X | Predicted | e4j5xA1 e4j5xB1 | |||
| 4NY9 | Predicted | e4ny9A1 | |||
| 4S0S | Predicted | e4s0sA1 e4s0sB1 | |||
| 4S0T | Predicted | e4s0tB1 e4s0tA1 | |||
| 4X1F | Predicted | e4x1fA1 | |||
| 4X1G | Predicted | e4x1gA1 | |||
| 4XAO | Predicted | e4xaoA1 | |||
| 4XHD | Predicted | e4xhdA1 | |||
| 5A86 | Predicted | e5a86A1 e5a86B1 | |||
| 5X0R | Predicted | e5x0rA1 e5x0rB1 | |||
| 6BNS | Predicted | e6bnsA1 e6bnsB1 | |||
| 6DUP | Predicted | e6dupA1 e6dupB1 | |||
| 6S41 | Predicted | e6s41B1 e6s41A1 |