DB01727 Isocitric Acid
InChI Key: ODBLHEXUDAPZAU-OKKQSCSOSA-N
SMILES: O[C@@H]([C@H](CC(O)=O)C(O)=O)C(O)=O
Small molecule PDB accession : N81
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein O75874
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| O75874 | Download | Predicted | O75874_nD1 O75874_nD2 | Isocitrate/Isopropylmalate dehydrogenase-like Isocitrate/Isopropylmalate dehydrogenase-like | |
| 1T09 | Predicted | ||||
| 1T0L | Predicted | ||||
| 3INM | Predicted | ||||
| 3MAP | Predicted | ||||
| 3MAR | Predicted | ||||
| 3MAS | Predicted | ||||
| 4I3K | Predicted | ||||
| 4I3L | Predicted | ||||
| 4KZO | Predicted | ||||
| 4L03 | Predicted | ||||
| 4L04 | Predicted | ||||
| 4L06 | Predicted | ||||
| 4UMX | Predicted | ||||
| 4UMY | Predicted | ||||
| 4XRX | Predicted | ||||
| 4XS3 | Predicted | ||||
| 5DE1 | Predicted | ||||
| 5GIR | Predicted | ||||
| 5K10 | Predicted | ||||
| 5K11 | Predicted | ||||
| 5L57 | Predicted | ||||
| 5L58 | Predicted | ||||
| 5LGE | Predicted | ||||
| 5SUN | Predicted | ||||
| 5SVF | Predicted | ||||
| 5TQH | Predicted | ||||
| 5YFM | Predicted | ||||
| 5YFN | Predicted | ||||
| 6ADG | Predicted | ||||
| 6B0Z | Predicted | ||||
| 6BKX | Predicted | ||||
| 6BKY | Predicted | ||||
| 6BKZ | Predicted | ||||
| 6BL0 | Predicted | ||||
| 6BL1 | Predicted | ||||
| 6BL2 | Predicted | ||||
| 6IO0 | Predicted | ||||
| 6O2Y | Predicted | ||||
| 6O2Z | Predicted | ||||
| 6PAY | Predicted | ||||
| 6Q6F | Predicted | ||||
| 6U4J | Predicted | ||||
| 6VEI | Predicted | ||||
| 6VG0 | Predicted |