DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein O96013
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| O96013 | Download | Predicted | O96013_nD2 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 2BVA | Predicted | e2bvaA1 e2bvaB1 | |||
| 2CDZ | Predicted | e2cdzA1 | |||
| 2J0I | Predicted | e2j0iA1 | |||
| 2Q0N | Predicted | e2q0nA1 | |||
| 2X4Z | Predicted | e2x4zA1 | |||
| 4APP | Predicted | e4appA1 | |||
| 4FIE | Predicted | e4fieB2 e4fieA1 | |||
| 4FIF | Predicted | e4fifA1 e4fifB1 | |||
| 4FIG | Predicted | e4figA1 e4figB1 | |||
| 4FIH | Predicted | e4fihA1 | |||
| 4FII | Predicted | e4fiiA1 | |||
| 4FIJ | Predicted | e4fijA1 | |||
| 4JDH | Predicted | e4jdhA1 | |||
| 4JDI | Predicted | e4jdiA1 | |||
| 4JDJ | Predicted | e4jdjA1 | |||
| 4JDK | Predicted | e4jdkA1 | |||
| 4L67 | Predicted | e4l67A1 | |||
| 4NJD | Predicted | e4njdA1 | |||
| 4O0V | Predicted | e4o0vA1 | |||
| 4O0X | Predicted | e4o0xA1 | |||
| 4O0Y | Predicted | e4o0yA1 | |||
| 4XBU | Predicted | e4xbuA1 | |||
| 5BMS | Predicted | e5bmsA1 | |||
| 5I0B | Predicted | e5i0bA1 | |||
| 5UPK | Predicted | e5upkA1 e5upkB1 | |||
| 5UPL | Predicted | e5uplA1 | |||
| 5VED | Predicted | e5vedA1 | |||
| 5VEE | Predicted | e5veeA1 | |||
| 5VEF | Predicted | e5vefA1 | |||
| 5XVA | Predicted | e5xvaA1 | |||
| 5XVF | Predicted | e5xvfA1 | |||
| 5XVG | Predicted | e5xvgA1 | |||
| 5ZJW | Predicted | e5zjwA1 |