DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein O96017
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
O96017 | Download | Predicted | O96017_nD1 O96017_nD2 | SMAD/FHA domain Protein kinase/SAICAR synthase/ATP-grasp | |
1GXC | Predicted | e1gxcA1 e1gxcD1 e1gxcG1 e1gxcJ1 | |||
2CN5 | Predicted | e2cn5A1 | |||
2CN8 | Predicted | e2cn8A1 | |||
2W0J | Predicted | e2w0jA1 | |||
2W7X | Predicted | e2w7xA1 | |||
2WTC | Predicted | e2wtcA1 | |||
2WTD | Predicted | e2wtdA1 | |||
2WTI | Predicted | e2wtiA1 | |||
2WTJ | Predicted | e2wtjA1 | |||
2XBJ | Predicted | e2xbjA1 | |||
2XK9 | Predicted | e2xk9A1 | |||
2XM8 | Predicted | e2xm8A1 | |||
2XM9 | Predicted | e2xm9A1 | |||
2YCF | Predicted | e2ycfA1 | |||
2YCQ | Predicted | e2ycqA1 | |||
2YCR | Predicted | e2ycrA1 | |||
2YCS | Predicted | e2ycsA1 | |||
2YIQ | Predicted | e2yiqA1 | |||
2YIR | Predicted | e2yirA1 | |||
2YIT | Predicted | e2yitA1 | |||
3I6U | Predicted | e3i6uA2 e3i6uB2 e3i6uA1 e3i6uB1 | |||
3I6W | Predicted | e3i6wA1 e3i6wB2 e3i6wC2 e3i6wD2 e3i6wE2 e3i6wF2 e3i6wG2 e3i6wH2 e3i6wA2 e3i6wB1 e3i6wC1 e3i6wD1 e3i6wE1 e3i6wF1 e3i6wG1 e3i6wH1 | |||
4A9R | Predicted | e4a9rA1 | |||
4A9S | Predicted | e4a9sA2 | |||
4A9T | Predicted | e4a9tA2 | |||
4A9U | Predicted | e4a9uA2 | |||
4BDA | Predicted | e4bdaA1 | |||
4BDB | Predicted | e4bdbA1 | |||
4BDC | Predicted | e4bdcA1 | |||
4BDD | Predicted | e4bddA1 | |||
4BDE | Predicted | e4bdeA1 | |||
4BDF | Predicted | e4bdfA1 | |||
4BDG | Predicted | e4bdgA1 | |||
4BDH | Predicted | e4bdhA1 | |||
4BDI | Predicted | e4bdiA1 | |||
4BDJ | Predicted | e4bdjA1 | |||
4BDK | Predicted | e4bdkA1 |