DB06813 Pralatrexate
InChI Key: OGSBUKJUDHAQEA-WMCAAGNKSA-N
SMILES: NC1=NC2=NC=C(CC(CC#C)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)N=C2C(N)=N1
Small molecule PDB accession : n/a
Drug action: substrate
List of PDB structures and/or AlphaFold models with target protein P00374
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P00374 | Download | Predicted | P00374_nD1 | Dihydrofolate reductases | |
| 1BOZ | Predicted | e1bozA1 | |||
| 1DHF | Predicted | e1dhfA1 e1dhfB1 | |||
| 1DLR | Predicted | e1dlrA1 | |||
| 1DLS | Predicted | e1dlsA1 | |||
| 1DRF | Predicted | e1drfA1 | |||
| 1HFP | Predicted | e1hfpA1 | |||
| 1HFQ | Predicted | e1hfqA1 | |||
| 1HFR | Predicted | e1hfrA1 | |||
| 1KMS | Predicted | e1kmsA1 | |||
| 1KMV | Predicted | e1kmvA1 | |||
| 1MVS | Predicted | e1mvsA1 | |||
| 1MVT | Predicted | e1mvtA1 | |||
| 1OHJ | Predicted | e1ohjA1 | |||
| 1OHK | Predicted | e1ohkA1 | |||
| 1PD8 | Predicted | e1pd8A1 | |||
| 1PD9 | Predicted | e1pd9A1 | |||
| 1PDB | Predicted | e1pdbA1 | |||
| 1S3U | Predicted | e1s3uA1 | |||
| 1S3V | Predicted | e1s3vA1 | |||
| 1S3W | Predicted | e1s3wA1 | |||
| 1U71 | Predicted | e1u71A1 | |||
| 1U72 | Predicted | e1u72A1 | |||
| 1YHO | Predicted | e1yhoA1 | |||
| 2C2S | Predicted | e2c2sA1 e2c2sB1 | |||
| 2C2T | Predicted | e2c2tB1 e2c2tA1 | |||
| 2DHF | Predicted | e2dhfB1 e2dhfA1 | |||
| 2W3A | Predicted | e2w3aA1 e2w3aB1 | |||
| 2W3B | Predicted | e2w3bA1 e2w3bB1 | |||
| 2W3M | Predicted | e2w3mA1 e2w3mB1 | |||
| 3EIG | Predicted | e3eigA1 | |||
| 3F8Y | Predicted | e3f8yA1 | |||
| 3F8Z | Predicted | e3f8zA1 | |||
| 3F91 | Predicted | e3f91A1 | |||
| 3FS6 | Predicted | e3fs6A1 | |||
| 3GHC | Predicted | e3ghcA1 | |||
| 3GHV | Predicted | e3ghvA1 | |||
| 3GHW | Predicted | e3ghwA1 | |||
| 3GI2 | Predicted | e3gi2A1 | |||
| 3GYF | Predicted | e3gyfA1 | |||
| 3L3R | Predicted | e3l3rA1 | |||
| 3N0H | Predicted | e3n0hA1 | |||
| 3NTZ | Predicted | e3ntzA1 | |||
| 3NU0 | Predicted | e3nu0A1 | |||
| 3NXO | Predicted | e3nxoA1 | |||
| 3NXR | Predicted | e3nxrA1 | |||
| 3NXT | Predicted | e3nxtA1 | |||
| 3NXV | Predicted | e3nxvA1 | |||
| 3NXX | Predicted | e3nxxA1 | |||
| 3NXY | Predicted | e3nxyA1 | |||
| 3NZD | Predicted | e3nzdA1 | |||
| 3OAF | Predicted | e3oafA1 | |||
| 3S3V | Predicted | e3s3vA1 | |||
| 3S7A | Predicted | e3s7aA1 | |||
| 4DDR | Predicted | e4ddrA1 | |||
| 4G95 | Predicted | e4g95A1 | |||
| 4KAK | Predicted | e4kakA1 e4kakB1 | |||
| 4KBN | Predicted | e4kbnA1 e4kbnB1 | |||
| 4KD7 | Predicted | e4kd7A1 e4kd7B1 | |||
| 4KEB | Predicted | e4kebA1 e4kebB1 | |||
| 4KFJ | Predicted | e4kfjA1 e4kfjB1 | |||
| 4M6J | Predicted | e4m6jA1 | |||
| 4M6K | Predicted | e4m6kA1 | |||
| 4M6L | Predicted | e4m6lA1 | |||
| 4QHV | Predicted | e4qhvA1 | |||
| 4QJC | Predicted | e4qjcA1 | |||
| 5HPB | Predicted | e5hpbA1 | |||
| 5HQY | Predicted | e5hqyA1 | |||
| 5HQZ | Predicted | e5hqzA1 | |||
| 5HSR | Predicted | e5hsrA1 | |||
| 5HSU | Predicted | e5hsuA1 | |||
| 5HT4 | Predicted | e5ht4A1 | |||
| 5HT5 | Predicted | e5ht5A1 | |||
| 5HUI | Predicted | e5huiA1 | |||
| 5HVB | Predicted | e5hvbA1 | |||
| 5HVE | Predicted | e5hveA1 | |||
| 6A7C | Predicted | e6a7cA1 | |||
| 6A7E | Predicted | e6a7eA1 | |||
| 6DAV | Predicted | e6davA1 e6davB1 | |||
| 6DE4 | Predicted | e6de4A1 e6de4B1 |