DB14487 Zinc acetate
InChI Key: DJWUNCQRNNEAKC-UHFFFAOYSA-L
SMILES: [Zn++].CC([O-])=O.CC([O-])=O
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P00748
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P00748 | Download | Predicted | P00748_nD5 P00748_nD6 | Kringle-like cradle loop barrel | |
| 4BDW | Predicted | e4bdwA1 e4bdwA2 | |||
| 4BDX | Predicted | e4bdxA1 e4bdxA2 | |||
| 4XDE | Predicted | e4xdeA1 | |||
| 4XE4 | Predicted | e4xe4A1 | |||
| 6B74 | Predicted | e6b74B1 | |||
| 6B77 | Predicted | e6b77B1 | |||
| 6GT6 | Predicted | e6gt6B1 | |||
| 6QF7 | Predicted | e6qf7B1 e6qf7D1 |