DB01088 Iloprost
InChI Key: HIFJCPQKFCZDDL-ACWOEMLNSA-N
SMILES: [H][C@]12C[C@@H](O)[C@H](\C=C\[C@@H](O)C(C)CC#CC)[C@@]1([H])C\C(C2)=C\CCCC(O)=O
Small molecule PDB accession : n/a
Drug action: other/unknown
List of PDB structures and/or AlphaFold models with target protein P00750
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P00750 | Download | Predicted | P00750_nD5 P00750_nD4 P00750_nD2 | cradle loop barrel Kringle-like EGF-like | |
| 1A5H | Predicted | e1a5h.1 e1a5h.2 | |||
| 1BDA | Predicted | e1bdaB1 e1bdaA1 | |||
| 1PK2 | Predicted | e1pk2A1 | |||
| 1PML | Predicted | e1pmlB1 e1pmlA1 e1pmlC1 | |||
| 1RTF | Predicted | e1rtf.1 | |||
| 1TPG | Predicted | e1tpgA4 e1tpgA3 | |||
| 1TPK | Predicted | e1tpkB1 e1tpkA1 e1tpkC1 | |||
| 1TPM | Predicted | e1tpmA1 | |||
| 1TPN | Predicted | e1tpnA1 | |||
| 5BRR | Predicted | e5brrE1 | |||
| 5ZLZ | Predicted | e5zlzE1 |