DB05961 PPL-100
InChI Key: QAHLFXYLXBBCPS-IZEXYCQBSA-N
SMILES: COC(=O)N[C@@H](C(C1=CC=CC=C1)C1=CC=CC=C1)C(=O)NCCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)C1=CC=C(N)C=C1
Small molecule PDB accession : A00
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P01009
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P01009 | Download | Predicted | P01009_nD1 | Serpins | |
| 1ATU | Predicted | e1atuA1 | |||
| 1D5S | Predicted | e1d5s.1 | |||
| 1EZX | Predicted | e1ezx.1 | |||
| 1HP7 | Predicted | e1hp7A1 | |||
| 1IZ2 | Predicted | e1iz2A1 | |||
| 1KCT | Predicted | e1kctA1 | |||
| 1OO8 | Predicted | e1oo8A1 | |||
| 1OPH | Predicted | e1ophA1 | |||
| 1PSI | Predicted | e1psiA1 | |||
| 1QLP | Predicted | e1qlpA1 | |||
| 1QMB | Predicted | e1qmb.1 | |||
| 2D26 | Predicted | e2d26.2 | |||
| 2QUG | Predicted | e2qugA1 | |||
| 3CWL | Predicted | e3cwlA1 | |||
| 3CWM | Predicted | e3cwmA1 | |||
| 3DRM | Predicted | e3drmA1 | |||
| 3DRU | Predicted | e3druA1 e3druB1 e3druC1 | |||
| 3NDD | Predicted | e3ndd.1 | |||
| 3NDF | Predicted | e3ndf.1 | |||
| 3NE4 | Predicted | e3ne4A1 | |||
| 3T1P | Predicted | e3t1pA1 | |||
| 4PYW | Predicted | e4pyw.2 | |||
| 5IO1 | Predicted | e5io1A1 e5io1B1 | |||
| 5NBU | Predicted | e5nbuA1 | |||
| 5NBV | Predicted | e5nbvA1 | |||
| 6HX4 | Predicted | e6hx4B1 e6hx4A1 | |||
| 6I4V | Predicted | e6i4vA1 | |||
| 6I7U | Predicted | e6i7uA1 | |||
| 6IAY | Predicted | e6iayA1 | |||
| 7API | Predicted | e7api.1 | |||
| 8API | Predicted | e8api.1 | |||
| 9API | Predicted | e9api.1 |