DB05412 Talmapimod
InChI Key: ZMELOYOKMZBMRB-DLBZAZTESA-N
SMILES: [H][C@]1(C)CN(C(=O)C2=C(Cl)C=C3N(C)C=C(C(=O)C(=O)N(C)C)C3=C2)[C@]([H])(C)CN1CC1=CC=C(F)C=C1
Small molecule PDB accession : 469
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P01584
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P01584 | Download | Predicted | P01584_nD1 | beta-Trefoil | |
1HIB | Predicted | e1hibA1 | |||
1I1B | Predicted | e1i1bA1 | |||
1IOB | Predicted | e1iobA1 | |||
1ITB | Predicted | e1itbA1 | |||
1L2H | Predicted | e1l2hA1 | |||
1S0L | Predicted | e1s0lA1 | |||
1T4Q | Predicted | e1t4qA1 | |||
1TOO | Predicted | e1tooA1 | |||
1TP0 | Predicted | e1tp0A1 | |||
1TWE | Predicted | e1tweA1 | |||
1TWM | Predicted | e1twmA1 | |||
21BI | Predicted | e21biA1 | |||
2I1B | Predicted | e2i1bA1 | |||
2KH2 | Predicted | e2kh2A1 | |||
2NVH | Predicted | e2nvhA1 | |||
31BI | Predicted | e31biA1 | |||
3LTQ | Predicted | e3ltqA1 | |||
3O4O | Predicted | e3o4oA1 | |||
3POK | Predicted | e3pokA1 | |||
41BI | Predicted | e41biA1 | |||
4DEP | Predicted | e4depA1 e4depD1 | |||
4G6J | Predicted | e4g6jA1 | |||
4G6M | Predicted | e4g6mA1 | |||
4GAF | Predicted | e4gafA1 | |||
4GAI | Predicted | e4gaiB1 e4gaiA1 | |||
4I1B | Predicted | e4i1bA1 | |||
5BVP | Predicted | e5bvpI1 | |||
5I1B | Predicted | e5i1bA1 | |||
5MVZ | Predicted | e5mvzU1 e5mvzV1 | |||
6I1B | Predicted | e6i1bA1 | |||
7I1B | Predicted | e7i1bA1 | |||
9ILB | Predicted | e9ilbA1 |