DB05767 Andrographolide
InChI Key: BOJKULTULYSRAS-OTESTREVSA-N
SMILES: [H][C@]12CCC(=C)[C@@H](C\C=C3/[C@H](O)COC3=O)[C@]1(C)CC[C@@H](O)[C@@]2(C)CO
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P01584
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P01584 | Download | Predicted | P01584_nD1 | beta-Trefoil | |
| 1HIB | Predicted | e1hibA1 | |||
| 1I1B | Predicted | e1i1bA1 | |||
| 1IOB | Predicted | e1iobA1 | |||
| 1ITB | Predicted | e1itbA1 | |||
| 1L2H | Predicted | e1l2hA1 | |||
| 1S0L | Predicted | e1s0lA1 | |||
| 1T4Q | Predicted | e1t4qA1 | |||
| 1TOO | Predicted | e1tooA1 | |||
| 1TP0 | Predicted | e1tp0A1 | |||
| 1TWE | Predicted | e1tweA1 | |||
| 1TWM | Predicted | e1twmA1 | |||
| 21BI | Predicted | e21biA1 | |||
| 2I1B | Predicted | e2i1bA1 | |||
| 2KH2 | Predicted | e2kh2A1 | |||
| 2NVH | Predicted | e2nvhA1 | |||
| 31BI | Predicted | e31biA1 | |||
| 3LTQ | Predicted | e3ltqA1 | |||
| 3O4O | Predicted | e3o4oA1 | |||
| 3POK | Predicted | e3pokA1 | |||
| 41BI | Predicted | e41biA1 | |||
| 4DEP | Predicted | e4depA1 e4depD1 | |||
| 4G6J | Predicted | e4g6jA1 | |||
| 4G6M | Predicted | e4g6mA1 | |||
| 4GAF | Predicted | e4gafA1 | |||
| 4GAI | Predicted | e4gaiB1 e4gaiA1 | |||
| 4I1B | Predicted | e4i1bA1 | |||
| 5BVP | Predicted | e5bvpI1 | |||
| 5I1B | Predicted | e5i1bA1 | |||
| 5MVZ | Predicted | e5mvzU1 e5mvzV1 | |||
| 6I1B | Predicted | e6i1bA1 | |||
| 7I1B | Predicted | e7i1bA1 | |||
| 9ILB | Predicted | e9ilbA1 |