DB08647 Trazeolide
InChI Key: YUTXECPABXNXPU-DJJJIMSYSA-N
SMILES: [H][C@]1(C)[C@]([H])(C(C)C)C2=C(C=C(C)C(=C2)C(=O)CCC(O)=O)C1(C)C
Small molecule PDB accession : TRZ
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P01834
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P01834 | Download | Predicted | P01834_nD1 | Immunoglobulin-like beta-sandwich | |
| 1A4J | Predicted | e1a4jA2 e1a4jL2 | |||
| 1A4K | Predicted | e1a4kL2 e1a4kA2 | |||
| 1CLY | Predicted | e1clyL2 | |||
| 1D5B | Predicted | e1d5bA2 e1d5bL2 | |||
| 1D5I | Predicted | e1d5iL2 | |||
| 1D6V | Predicted | e1d6vL2 | |||
| 1DFB | Predicted | e1dfbL2 | |||
| 1GAF | Predicted | e1gafL2 | |||
| 1HEZ | Predicted | e1hezA2 e1hezC2 | |||
| 1HKL | Predicted | e1hklL2 | |||
| 1HZH | Predicted | e1hzhL2 e1hzhM2 | |||
| 1I7Z | Predicted | e1i7zA2 e1i7zC2 | |||
| 1MIM | Predicted | e1mimL2 | |||
| 1N0X | Predicted | e1n0xM2 | |||
| 1UCB | Predicted | e1ucbL2 | |||
| 2NY7 | Predicted | e2ny7L2 | |||
| 3IU3 | Predicted | e3iu3B2 e3iu3D2 e3iu3L2 | |||
| 3O11 | Predicted | e3o11A2 e3o11L2 | |||
| 3RU8 | Predicted | e3ru8L2 | |||
| 3U0W | Predicted | e3u0wL2 | |||
| 4D3C | Predicted | e4d3cL2 | |||
| 4HIX | Predicted | e4hixL2 | |||
| 4NM4 | Predicted | e4nm4L1 e4nm4M1 | |||
| 4NM8 | Predicted | e4nm8L1 e4nm8M1 e4nm8N1 | |||
| 4XXD | Predicted | e4xxdA2 e4xxdD2 | |||
| 4YDV | Predicted | e4ydvL2 e4ydvA1 | |||
| 6DCV | Predicted | e6dcvL2 e6dcvA2 | |||
| 6DCW | Predicted | e6dcwL1 |