DB14487 Zinc acetate
InChI Key: DJWUNCQRNNEAKC-UHFFFAOYSA-L
SMILES: [Zn++].CC([O-])=O.CC([O-])=O
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P02649
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P02649 | Download | Predicted | P02649_nD1 | Long alpha-hairpin | |
1B68 | Predicted | e1b68A1 | |||
1BZ4 | Predicted | e1bz4A1 | |||
1EA8 | Predicted | e1ea8A1 | |||
1GS9 | Predicted | e1gs9A1 | |||
1H7I | Predicted | e1h7iA1 | |||
1LE2 | Predicted | e1le2A1 | |||
1LE4 | Predicted | e1le4A1 | |||
1LPE | Predicted | e1lpeA1 | |||
1NFN | Predicted | e1nfnA1 | |||
1NFO | Predicted | e1nfoA1 | |||
1OR2 | Predicted | e1or2A1 | |||
1OR3 | Predicted | e1or3A1 | |||
2KC3 | Predicted | e2kc3A1 | |||
2L7B | Predicted | e2l7bA1 | |||
6IWB | Predicted | e6iwbC1 e6iwbA1 | |||
6NCN | Predicted | e6ncnA1 | |||
6NCO | Predicted | e6ncoA1 |