DB04224 Oleic Acid
InChI Key: ZQPPMHVWECSIRJ-MDZDMXLPSA-N
SMILES: CCCCCCCC\C=C\CCCCCCCC(O)=O
Small molecule PDB accession : ELA
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P02689
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P02689 | Download | Predicted | P02689_nD1 | Lipocalins/Streptavidin | |
2WUT | Predicted | e2wutA1 | |||
3NR3 | Predicted | e3nr3A1 | |||
4A1H | Predicted | e4a1hA1 e4a1hC1 e4a1hB1 | |||
4A1Y | Predicted | e4a1yA1 e4a1yD1 e4a1yB1 e4a1yC1 | |||
4A8Z | Predicted | e4a8zA1 | |||
4BVM | Predicted | e4bvmA1 | |||
4D6A | Predicted | e4d6aA1 | |||
4D6B | Predicted | e4d6bA1 | |||
5N4M | Predicted | e5n4mA1 | |||
5N4P | Predicted | e5n4pA1 | |||
5N4Q | Predicted | e5n4qA1 | |||
6EW2 | Predicted | e6ew2A1 | |||
6EW4 | Predicted | e6ew4A1 | |||
6EW5 | Predicted | e6ew5A1 e6ew5B1 e6ew5C1 e6ew5D1 | |||
6S2M | Predicted | e6s2mA1 | |||
6S2S | Predicted | e6s2sA1 |