DB12831 Gabexate
InChI Key: YKGYIDJEEQRWQH-UHFFFAOYSA-N
SMILES: CCOC(=O)C1=CC=C(OC(=O)CCCCCNC(N)=N)C=C1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P03952
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P03952 | Download | Predicted | P03952_nD4 P03952_nD5 P03952_nD1 P03952_nD2 P03952_nD3 | Hairpin loop containing domain-like cradle loop barrel Hairpin loop containing domain-like Hairpin loop containing domain-like Hairpin loop containing domain-like | |
| 2ANW | Predicted | e2anwA1 | |||
| 2ANY | Predicted | e2anyA1 | |||
| 4OGX | Predicted | e4ogxA1 | |||
| 4OGY | Predicted | e4ogyA1 e4ogyB1 | |||
| 5F8T | Predicted | e5f8tA1 | |||
| 5F8X | Predicted | e5f8xA1 | |||
| 5F8Z | Predicted | e5f8zA1 | |||
| 5TJX | Predicted | e5tjxA1 | |||
| 6I44 | Predicted | e6i44A1 e6i44A3 e6i44A2 e6i44A5 e6i44A4 | |||
| 6O1G | Predicted | e6o1gA2 e6o1gA1 e6o1gA3 e6o1gA4 e6o1gA5 | |||
| 6O1S | Predicted | e6o1sE1 |