DB07926 N-[3-(N'-HYDROXYCARBOXAMIDO)-2-(2-METHYLPROPYL)-PROPANOYL]-O-TYROSINE-N-METHYLAMIDE
InChI Key: QYZPDCGWIJYZMN-ZBFHGGJFSA-N
SMILES: [H][C@@](CC(C)C)(CC(=O)NO)C(=O)N[C@@]([H])(CC1=CC=C(OC)C=C1)C(=O)NC
Small molecule PDB accession : HTA
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P03956
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P03956 | Download | Predicted | P03956_nD3 P03956_nD2 P03956_nD1 | beta-propeller-like Zincin-like PGBD-like | |
| 1AYK | Predicted | e1aykA1 | |||
| 1CGE | Predicted | e1cgeA1 | |||
| 1CGF | Predicted | e1cgfB1 e1cgfA1 | |||
| 1CGL | Predicted | e1cglA1 e1cglB1 | |||
| 1HFC | Predicted | e1hfcA1 | |||
| 1SU3 | Predicted | e1su3A1 e1su3B1 e1su3A2 e1su3B2 e1su3B3 e1su3A3 | |||
| 2AYK | Predicted | e2aykA1 | |||
| 2CLT | Predicted | e2cltA1 e2cltB1 e2cltA2 e2cltB2 | |||
| 2J0T | Predicted | e2j0tA1 e2j0tB1 e2j0tC1 | |||
| 2TCL | Predicted | e2tclA1 | |||
| 3AYK | Predicted | e3aykA1 | |||
| 3SHI | Predicted | e3shiA1 e3shiG1 e3shiM1 | |||
| 4AUO | Predicted | e4auoA1 e4auoB1 e4auoA2 e4auoB2 | |||
| 4AYK | Predicted | e4aykA1 | |||
| 966C | Predicted | e966cA1 |