DB08912 Dabrafenib
InChI Key: BFSMGDJOXZAERB-UHFFFAOYSA-N
SMILES: CC(C)(C)C1=NC(=C(S1)C1=NC(N)=NC=C1)C1=C(F)C(NS(=O)(=O)C2=C(F)C=CC=C2F)=CC=C1
Small molecule PDB accession : P06
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P04049
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P04049 | Download | Predicted | P04049_nD3 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 1C1Y | Predicted | e1c1yB1 | |||
| 1FAQ | Predicted | e1faqA1 | |||
| 1FAR | Predicted | e1farA1 | |||
| 1GUA | Predicted | e1guaB1 | |||
| 1RFA | Predicted | e1rfaA1 | |||
| 3KUC | Predicted | e3kucB1 | |||
| 3KUD | Predicted | e3kudB1 | |||
| 3OMV | Predicted | e3omvA1 e3omvB1 | |||
| 4G0N | Predicted | e4g0nB1 | |||
| 4G3X | Predicted | e4g3xB1 |