DB00421 Spironolactone
InChI Key: LXMSZDCAJNLERA-ZHYRCANASA-N
SMILES: [H][C@@]12CC[C@@]3(CCC(=O)O3)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])[C@@]([H])(CC2=CC(=O)CC[C@]12C)SC(C)=O
Small molecule PDB accession : SNL
Drug action: binder
List of PDB structures and/or AlphaFold models with target protein P04278
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P04278 | Download | Predicted | P04278_nD1 P04278_nD2 | jelly-roll jelly-roll | |
| 1D2S | Predicted | e1d2sA1 | |||
| 1F5F | Predicted | e1f5fA1 | |||
| 1KDK | Predicted | e1kdkA1 | |||
| 1KDM | Predicted | e1kdmA1 | |||
| 1LHN | Predicted | e1lhnA1 | |||
| 1LHO | Predicted | e1lhoA1 | |||
| 1LHU | Predicted | e1lhuA1 | |||
| 1LHV | Predicted | e1lhvA1 | |||
| 1LHW | Predicted | e1lhwA1 | |||
| 6PYA | Predicted | e6pyaA1 | |||
| 6PYB | Predicted | e6pybA1 | |||
| 6PYF | Predicted | e6pyfA1 |