DB00619 Imatinib
InChI Key: KTUFNOKKBVMGRW-UHFFFAOYSA-N
SMILES: CN1CCN(CC2=CC=C(C=C2)C(=O)NC2=CC(NC3=NC=CC(=N3)C3=CN=CC=C3)=C(C)C=C2)CC1
Small molecule PDB accession : STI
Drug action: antagonist
List of drug binding-associated PTMs
List of PDB structures and/or AlphaFold models with target protein P04629
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P04629 | Download | Predicted | P04629_nD4 | Protein kinase/SAICAR synthase/ATP-grasp | |
1HE7 | Predicted | e1he7A1 | |||
1WWA | Predicted | e1wwaX1 e1wwaY1 | |||
1WWW | Predicted | e1wwwX1 e1wwwY1 | |||
2IFG | Predicted | e2ifgA1 e2ifgB1 e2ifgA4 e2ifgB4 e2ifgA2 e2ifgB2 | |||
2N90 | Predicted | e2n90A1 e2n90B1 | |||
4AOJ | Predicted | e4aojA1 e4aojC1 e4aojB1 | |||
4CRP | Predicted | e4crpA1 | |||
4F0I | Predicted | e4f0iA1 e4f0iB2 | |||
4GT5 | Predicted | e4gt5A1 | |||
4PMM | Predicted | e4pmmA1 | |||
4PMP | Predicted | e4pmpA1 | |||
4PMS | Predicted | e4pmsA1 | |||
4PMT | Predicted | e4pmtA1 | |||
4YNE | Predicted | e4yneA1 | |||
4YPS | Predicted | e4ypsA1 | |||
5H3Q | Predicted | e5h3qA1 | |||
5I8A | Predicted | e5i8aA1 | |||
5JFS | Predicted | e5jfsA1 | |||
5JFV | Predicted | e5jfvA1 | |||
5JFW | Predicted | e5jfwA1 | |||
5JFX | Predicted | e5jfxA1 | |||
5KMI | Predicted | e5kmiA1 | |||
5KMJ | Predicted | e5kmjA1 | |||
5KMK | Predicted | e5kmkA1 | |||
5KML | Predicted | e5kmlA1 | |||
5KMM | Predicted | e5kmmA1 | |||
5KMN | Predicted | e5kmnA1 | |||
5KMO | Predicted | e5kmoA1 | |||
5KVT | Predicted | e5kvtA1 | |||
5WR7 | Predicted | e5wr7A1 | |||
6D1Y | Predicted | e6d1yA1 | |||
6D1Z | Predicted | e6d1zA1 | |||
6D20 | Predicted | e6d20A1 | |||
6D22 | Predicted | e6d22A1 | |||
6DKB | Predicted | e6dkbA1 | |||
6DKG | Predicted | e6dkgA1 | |||
6DKI | Predicted | e6dkiA1 | |||
6DKW | Predicted | e6dkwA1 e6dkwB1 | |||
6J5L | Predicted | e6j5lA1 | |||
6NPT | Predicted | e6nptA1 | |||
6NSP | Predicted | e6nspA1 | |||
6NSS | Predicted | e6nssA1 | |||
6PL1 | Predicted | e6pl1A1 | |||
6PL2 | Predicted | e6pl2A1 | |||
6PL3 | Predicted | e6pl3A1 |