DB02587 Colforsin
InChI Key: OHCQJHSOBUTRHG-KGGHGJDLSA-N
SMILES: [H][C@]1(O)CCC(C)(C)[C@]2([H])[C@]([H])(O)[C@]([H])(OC(C)=O)[C@@]3(C)O[C@](C)(CC(=O)[C@]3(O)[C@@]12C)C=C
Small molecule PDB accession : FOK
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P05121
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P05121 | Download | Predicted | P05121_nD1 | Serpins | |
1A7C | Predicted | e1a7c.2 | |||
1B3K | Predicted | e1b3kC1 e1b3kA1 e1b3kB1 e1b3kD1 | |||
1C5G | Predicted | e1c5gA1 | |||
1DB2 | Predicted | e1db2A1 e1db2B1 | |||
1DVM | Predicted | e1dvmC1 e1dvmB1 e1dvmD1 e1dvmA1 | |||
1DVN | Predicted | e1dvnA1 | |||
1LJ5 | Predicted | e1lj5A1 | |||
1OC0 | Predicted | e1oc0A1 | |||
3CVM | Predicted | e3cvmA1 e3cvmB1 | |||
3EOX | Predicted | e3eoxA1 | |||
3PB1 | Predicted | e3pb1I1 | |||
3Q02 | Predicted | e3q02B1 e3q02A1 | |||
3Q03 | Predicted | e3q03B1 e3q03A1 | |||
3R4L | Predicted | e3r4lA1 | |||
3UT3 | Predicted | e3ut3C1 e3ut3D1 e3ut3B1 e3ut3A1 | |||
4AQH | Predicted | e4aqhB1 e4aqhC1 e4aqhA1 | |||
4G8O | Predicted | e4g8oA1 e4g8oB1 e4g8oC1 e4g8oD1 | |||
4G8R | Predicted | e4g8rB1 e4g8rA1 | |||
4IC0 | Predicted | e4ic0A1 e4ic0C1 e4ic0B1 e4ic0D1 | |||
5BRR | Predicted | e5brrI1 | |||
5ZLZ | Predicted | e5zlzI1 | |||
6GWN | Predicted | e6gwnA1 | |||
6GWP | Predicted | e6gwpA1 | |||
6GWQ | Predicted | e6gwqA1 | |||
6I8S | Predicted | e6i8sA1 e6i8sB1 e6i8sC1 e6i8sD1 | |||
9PAI | Predicted | e9pai.1 |