DB00535 Cefdinir
InChI Key: RTXOFQZKPXMALH-GHXIOONMSA-N
SMILES: [H][C@]12SCC(C=C)=C(N1C(=O)[C@H]2NC(=O)C(=N/O)\C1=CSC(N)=N1)C(O)=O
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P05164
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P05164 | Download | Predicted | P05164_nD2 P05164_nD1 | Heme-dependent peroxidases RRF/tRNA synthetase additional domain-like | |
| 1CXP | Predicted | e1cxp.1 e1cxp.2 | |||
| 1D2V | Predicted | e1d2v.1 e1d2v.2 | |||
| 1D5L | Predicted | e1d5l.1 e1d5l.2 | |||
| 1D7W | Predicted | e1d7w.1 e1d7w.2 | |||
| 1DNU | Predicted | e1dnu.1 e1dnu.2 | |||
| 1DNW | Predicted | e1dnw.1 e1dnw.2 | |||
| 1MHL | Predicted | e1mhl.1 e1mhl.2 | |||
| 1MYP | Predicted | e1myp.1 e1myp.2 | |||
| 3F9P | Predicted | e3f9p.1 e3f9p.2 | |||
| 3ZS0 | Predicted | e3zs0.1 e3zs0.2 | |||
| 3ZS1 | Predicted | e3zs1.1 e3zs1.2 | |||
| 4C1M | Predicted | e4c1m.1 e4c1m.2 | |||
| 4DL1 | Predicted | e4dl1.1 e4dl1.2 e4dl1.3 e4dl1.4 e4dl1.5 e4dl1.6 e4dl1.8 e4dl1.9 | |||
| 4EJX | Predicted | e4ejx.1 | |||
| 5FIW | Predicted | e5fiw.1 e5fiw.2 | |||
| 5MFA | Predicted | e5mfaA1 | |||
| 5UZU | Predicted | e5uzuA1 | |||
| 6AZP | Predicted | e6azpA1 | |||
| 6BMT | Predicted | e6bmtA1 |