DB03727 Coproporphyrin I
InChI Key: VORBHEGMEBOMMB-JRHDEHKPSA-N
SMILES: CC1=C(CCC(O)=O)/C2=C/C3=N/C(=C\C4=C(C)C(CCC(O)=O)=C(N4)/C=C4\N=C(\C=C\1/N\2)C(CCC(O)=O)=C4C)/C(CCC(O)=O)=C3C
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P06132
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P06132 | Download | Predicted | P06132_nD1 | TIM beta/alpha-barrel | |
1JPH | Predicted | e1jphA1 | |||
1JPI | Predicted | e1jpiA1 | |||
1JPK | Predicted | e1jpkA1 | |||
1R3Q | Predicted | e1r3qA1 | |||
1R3R | Predicted | e1r3rA1 | |||
1R3S | Predicted | e1r3sA1 | |||
1R3T | Predicted | e1r3tA1 | |||
1R3V | Predicted | e1r3vA1 | |||
1R3W | Predicted | e1r3wA1 | |||
1R3Y | Predicted | e1r3yA1 | |||
1URO | Predicted | e1uroA1 | |||
2Q6Z | Predicted | e2q6zA1 | |||
2Q71 | Predicted | e2q71A1 | |||
3GVQ | Predicted | e3gvqA1 | |||
3GVR | Predicted | e3gvrA1 | |||
3GVV | Predicted | e3gvvA1 | |||
3GVW | Predicted | e3gvwA1 | |||
3GW0 | Predicted | e3gw0A1 | |||
3GW3 | Predicted | e3gw3A1 |