DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P06241
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P06241 | Download | Predicted | P06241_nD3 P06241_nD2 P06241_nD1 | Protein kinase/SAICAR synthase/ATP-grasp SH2 SH3 | |
| 1A0N | Predicted | e1a0nB1 | |||
| 1AOT | Predicted | e1aotF1 | |||
| 1AOU | Predicted | e1aouF1 | |||
| 1AVZ | Predicted | e1avzC1 | |||
| 1AZG | Predicted | e1azgB1 | |||
| 1EFN | Predicted | e1efnA1 e1efnC1 | |||
| 1FYN | Predicted | e1fynA1 | |||
| 1G83 | Predicted | e1g83A1 e1g83B1 e1g83A2 e1g83B2 | |||
| 1M27 | Predicted | e1m27C1 | |||
| 1NYF | Predicted | e1nyfA1 | |||
| 1NYG | Predicted | e1nygA1 | |||
| 1SHF | Predicted | e1shfB1 e1shfA1 | |||
| 1ZBJ | Predicted | e1zbjA1 | |||
| 2DQ7 | Predicted | e2dq7X1 | |||
| 2MQI | Predicted | e2mqiA1 | |||
| 2MRJ | Predicted | e2mrjA1 | |||
| 2MRK | Predicted | e2mrkA1 | |||
| 3H0F | Predicted | e3h0fA1 | |||
| 3H0H | Predicted | e3h0hA1 | |||
| 3H0I | Predicted | e3h0iA1 e3h0iB1 | |||
| 3UA6 | Predicted | e3ua6B1 e3ua6A1 | |||
| 3UA7 | Predicted | e3ua7D1 e3ua7A1 e3ua7C1 e3ua7B1 | |||
| 4D8D | Predicted | e4d8dA1 e4d8dC1 | |||
| 4EIK | Predicted | e4eikA1 | |||
| 4U17 | Predicted | e4u17A1 e4u17B1 e4u17C1 | |||
| 4U1P | Predicted | e4u1pA1 | |||
| 4ZNX | Predicted | e4znxA1 e4znxB1 e4znxC1 e4znxD1 | |||
| 5ZAU | Predicted | e5zauA1 | |||
| 6EDF | Predicted | e6edfA1 | |||
| 6IPY | Predicted | e6ipyA1 | |||
| 6IPZ | Predicted | e6ipzZ1 |