DB06730 Gestodene
InChI Key: SIGSPDASOTUPFS-XUDSTZEESA-N
SMILES: CC[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@H]34)[C@@H]1C=C[C@@]2(O)C#C
Small molecule PDB accession : n/a
Drug action: binder
List of PDB structures and/or AlphaFold models with target protein P06401
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P06401 | Download | Predicted | P06401_nD1 P06401_nD2 | Glucocorticoid receptor-like Nuclear receptor ligand-binding domain | |
1A28 | Predicted | e1a28A1 e1a28B1 | |||
1E3K | Predicted | e1e3kA1 e1e3kB1 | |||
1SQN | Predicted | e1sqnB1 e1sqnA1 | |||
1SR7 | Predicted | e1sr7A1 e1sr7B1 | |||
1ZUC | Predicted | e1zucB1 e1zucA1 | |||
2C7A | Predicted | e2c7aA1 e2c7aB1 | |||
2OVH | Predicted | e2ovhA1 | |||
2OVM | Predicted | e2ovmA1 | |||
2W8Y | Predicted | e2w8yA1 e2w8yB1 | |||
3D90 | Predicted | e3d90A1 e3d90B1 | |||
3G8O | Predicted | e3g8oA1 e3g8oB1 | |||
3HQ5 | Predicted | e3hq5A1 e3hq5B1 | |||
3KBA | Predicted | e3kbaA1 e3kbaB1 | |||
3ZR7 | Predicted | e3zr7A1 e3zr7B1 | |||
3ZRA | Predicted | e3zraA1 e3zraB1 | |||
3ZRB | Predicted | e3zrbA1 e3zrbB1 | |||
4A2J | Predicted | e4a2jA1 e4a2jB1 | |||
4APU | Predicted | e4apuA1 e4apuB1 | |||
4OAR | Predicted | e4oarA1 | |||
5CC0 | Predicted | e5cc0A1 e5cc0B1 |