DB02950 Hymenialdisine
InChI Key: QPCBNXNDVYOBIP-WHFBIAKZSA-N
SMILES: [H][C@@]12C=C(Br)N=C1C(=O)NCC[C@]2([H])C1=NC(N)=NC1=O
Small molecule PDB accession : HMD
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P06493
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P06493 | Download | Predicted | P06493_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 4Y72 | Predicted | e4y72A1 | |||
| 4YC3 | Predicted | e4yc3A1 | |||
| 4YC6 | Predicted | e4yc6A1 e4yc6C1 e4yc6E1 e4yc6G1 | |||
| 5HQ0 | Predicted | e5hq0A1 | |||
| 5LQF | Predicted | e5lqfA1 e5lqfD1 | |||
| 6GU2 | Predicted | e6gu2A1 | |||
| 6GU3 | Predicted | e6gu3A1 | |||
| 6GU4 | Predicted | e6gu4A1 | |||
| 6GU6 | Predicted | e6gu6A1 | |||
| 6GU7 | Predicted | e6gu7A1 e6gu7C1 e6gu7G1 e6gu7E1 |