DB03496 Alvocidib
InChI Key: BIIVYFLTOXDAOV-YVEFUNNKSA-N
SMILES: CN1CC[C@@H]([C@H](O)C1)C1=C(O)C=C(O)C2=C1OC(=CC2=O)C1=CC=CC=C1Cl
Small molecule PDB accession : CPB
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P06493
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P06493 | Download | Predicted | P06493_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 4Y72 | Predicted | e4y72A1 | |||
| 4YC3 | Predicted | e4yc3A1 | |||
| 4YC6 | Predicted | e4yc6A1 e4yc6C1 e4yc6E1 e4yc6G1 | |||
| 5HQ0 | Predicted | e5hq0A1 | |||
| 5LQF | Predicted | e5lqfA1 e5lqfD1 | |||
| 6GU2 | Predicted | e6gu2A1 | |||
| 6GU3 | Predicted | e6gu3A1 | |||
| 6GU4 | Predicted | e6gu4A1 | |||
| 6GU6 | Predicted | e6gu6A1 | |||
| 6GU7 | Predicted | e6gu7A1 e6gu7C1 e6gu7G1 e6gu7E1 |