DB08217 S-[(1-Hydroxy-2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrol-3-yl)methyl] methanesulfonothioate
InChI Key: MXZPGYFBZHBAQM-UHFFFAOYSA-N
SMILES: CC1(C)C=C(CSS(C)(=O)=O)C(C)(C)N1O
Small molecule PDB accession : MTN
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P06730
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P06730 | Download | Predicted | P06730_nD1 | Translation initiation factor eIF4e and phosphothreonine lyase | |
| 1IPB | Predicted | e1ipbA1 | |||
| 1IPC | Predicted | e1ipcA1 | |||
| 1WKW | Predicted | e1wkwA1 | |||
| 2GPQ | Predicted | e2gpqA1 | |||
| 2V8W | Predicted | e2v8wA1 e2v8wE1 | |||
| 2V8X | Predicted | e2v8xA1 e2v8xE1 | |||
| 2V8Y | Predicted | e2v8yA1 e2v8yE1 | |||
| 2W97 | Predicted | e2w97A1 e2w97B1 | |||
| 3AM7 | Predicted | e3am7A1 | |||
| 3TF2 | Predicted | e3tf2A1 e3tf2B1 e3tf2C1 e3tf2D1 | |||
| 3U7X | Predicted | e3u7xA1 e3u7xB1 | |||
| 4AZA | Predicted | e4azaA1 e4azaC2 | |||
| 4BEA | Predicted | e4beaA1 | |||
| 4DT6 | Predicted | e4dt6A1 | |||
| 4DUM | Predicted | e4dumA2 | |||
| 4TPW | Predicted | e4tpwA1 e4tpwB1 | |||
| 4TQB | Predicted | e4tqbA1 e4tqbB1 | |||
| 4TQC | Predicted | e4tqcA1 e4tqcB1 | |||
| 4UED | Predicted | e4uedA1 | |||
| 5EHC | Predicted | e5ehcA1 | |||
| 5EI3 | Predicted | e5ei3A1 | |||
| 5EIR | Predicted | e5eirA1 | |||
| 5EKV | Predicted | e5ekvA1 e5ekvC1 | |||
| 5GW6 | Predicted | e5gw6A1 | |||
| 5T46 | Predicted | e5t46A1 e5t46C1 | |||
| 5ZJY | Predicted | e5zjyA1 | |||
| 5ZJZ | Predicted | e5zjzA1 | |||
| 5ZK5 | Predicted | e5zk5A1 | |||
| 5ZK7 | Predicted | e5zk7A1 e5zk7B1 | |||
| 5ZK9 | Predicted | e5zk9A1 | |||
| 5ZML | Predicted | e5zmlA1 |