DB14487 Zinc acetate
InChI Key: DJWUNCQRNNEAKC-UHFFFAOYSA-L
SMILES: [Zn++].CC([O-])=O.CC([O-])=O
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P07360
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P07360 | Download | Predicted | P07360_nD1 | Lipocalins/Streptavidin | |
| 1IW2 | Predicted | e1iw2A1 | |||
| 1LF7 | Predicted | e1lf7A1 | |||
| 2OVA | Predicted | e2ovaA1 | |||
| 2OVD | Predicted | e2ovdA1 | |||
| 2OVE | Predicted | e2oveA1 | |||
| 2QOS | Predicted | e2qosC1 | |||
| 2RD7 | Predicted | e2rd7C1 | |||
| 3OJY | Predicted | e3ojyC1 | |||
| 6H03 | Predicted | e6h03E1 | |||
| 6H04 | Predicted | e6h04E1 |