DB08808 Bupranolol
InChI Key: HQIRNZOQPUAHHV-UHFFFAOYSA-N
SMILES: CC1=CC(OCC(O)CNC(C)(C)C)=C(Cl)C=C1
Small molecule PDB accession : n/a
Drug action: antagonist
List of PDB structures and/or AlphaFold models with target protein P07550
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P07550 | Download | Predicted | P07550_nD1 | Family A G protein-coupled receptor-like | |
2R4R | Predicted | e2r4rA2 | |||
2R4S | Predicted | e2r4sA2 | |||
2RH1 | Predicted | ||||
3D4S | Predicted | e3d4sA4 e3d4sA3 | |||
3KJ6 | Predicted | e3kj6A2 | |||
3NY8 | Predicted | e3ny8A4 e3ny8A3 | |||
3NY9 | Predicted | e3ny9A4 | |||
3NYA | Predicted | e3nyaA4 | |||
3P0G | Predicted | e3p0gA1 | |||
3PDS | Predicted | e3pdsA4 e3pdsA3 | |||
3SN6 | Predicted | e3sn6R4 | |||
4GBR | Predicted | ||||
4LDE | Predicted | e4ldeA3 | |||
4LDL | Predicted | e4ldlA3 | |||
4LDO | Predicted | e4ldoA3 | |||
4QKX | Predicted | e4qkxA2 | |||
5D5A | Predicted | ||||
5D5B | Predicted | ||||
5D6L | Predicted | ||||
5JQH | Predicted | ||||
6MXT | Predicted | e6mxtA1 | |||
6N48 | Predicted | e6n48A2 | |||
6NI3 | Predicted | ||||
6PRZ | Predicted | e6przA2 | |||
6PS0 | Predicted | ||||
6PS1 | Predicted | ||||
6PS2 | Predicted | ||||
6PS3 | Predicted | ||||
6PS4 | Predicted | ||||
6PS5 | Predicted | ||||
6PS6 | Predicted |