DB09013 Befunolol
InChI Key: ZPQPDBIHYCBNIG-UHFFFAOYSA-N
SMILES: CC(C)NCC(O)COC1=CC=CC2=C1OC(=C2)C(C)=O
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P07550
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P07550 | Download | Predicted | P07550_nD1 | Family A G protein-coupled receptor-like | |
| 2R4R | Predicted | e2r4rA2 | |||
| 2R4S | Predicted | e2r4sA2 | |||
| 2RH1 | Predicted | ||||
| 3D4S | Predicted | e3d4sA4 e3d4sA3 | |||
| 3KJ6 | Predicted | e3kj6A2 | |||
| 3NY8 | Predicted | e3ny8A4 e3ny8A3 | |||
| 3NY9 | Predicted | e3ny9A4 | |||
| 3NYA | Predicted | e3nyaA4 | |||
| 3P0G | Predicted | e3p0gA1 | |||
| 3PDS | Predicted | e3pdsA4 e3pdsA3 | |||
| 3SN6 | Predicted | e3sn6R4 | |||
| 4GBR | Predicted | ||||
| 4LDE | Predicted | e4ldeA3 | |||
| 4LDL | Predicted | e4ldlA3 | |||
| 4LDO | Predicted | e4ldoA3 | |||
| 4QKX | Predicted | e4qkxA2 | |||
| 5D5A | Predicted | ||||
| 5D5B | Predicted | ||||
| 5D6L | Predicted | ||||
| 5JQH | Predicted | ||||
| 6MXT | Predicted | e6mxtA1 | |||
| 6N48 | Predicted | e6n48A2 | |||
| 6NI3 | Predicted | ||||
| 6PRZ | Predicted | e6przA2 | |||
| 6PS0 | Predicted | ||||
| 6PS1 | Predicted | ||||
| 6PS2 | Predicted | ||||
| 6PS3 | Predicted | ||||
| 6PS4 | Predicted | ||||
| 6PS5 | Predicted | ||||
| 6PS6 | Predicted |