DB11638 Artenimol
InChI Key: BJDCWCLMFKKGEE-HVDUHBCDSA-N
SMILES: [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4
Small molecule PDB accession : n/a
Drug action: ligand
List of PDB structures and/or AlphaFold models with target protein P07737
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P07737 | Download | Predicted | P07737_nD1 | Profilin-like | |
| 1AWI | Predicted | e1awiB1 e1awiA1 | |||
| 1CF0 | Predicted | e1cf0A1 e1cf0B1 | |||
| 1CJF | Predicted | e1cjfB1 e1cjfA1 | |||
| 1FIK | Predicted | e1fikA1 | |||
| 1FIL | Predicted | e1filA1 | |||
| 1PFL | Predicted | e1pflA1 | |||
| 2PAV | Predicted | e2pavP1 | |||
| 2PBD | Predicted | e2pbdP1 | |||
| 3CHW | Predicted | e3chwP1 | |||
| 4X1L | Predicted | e4x1lA1 | |||
| 4X1M | Predicted | e4x1mA1 | |||
| 4X25 | Predicted | e4x25A1 e4x25B1 |