DB04272 Citric acid
InChI Key: KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
Small molecule PDB accession : CIT
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P07741
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P07741 | Download | Predicted | P07741_nD1 | PRTase-like | |
| 1ORE | Predicted | e1oreA1 | |||
| 1ZN7 | Predicted | e1zn7A1 e1zn7B1 | |||
| 1ZN8 | Predicted | e1zn8B1 e1zn8A1 | |||
| 1ZN9 | Predicted | e1zn9A1 e1zn9B1 | |||
| 4X44 | Predicted | e4x44A1 | |||
| 4X45 | Predicted | e4x45A1 e4x45B1 | |||
| 6FCH | Predicted | e6fchA1 e6fchB1 | |||
| 6FCI | Predicted | e6fciA1 e6fciB1 e6fciC1 e6fciD1 | |||
| 6FCL | Predicted | e6fclA1 e6fclB1 | |||
| 6FD4 | Predicted | e6fd4B1 e6fd4A1 | |||
| 6FD5 | Predicted | e6fd5A1 e6fd5B1 | |||
| 6FD6 | Predicted | e6fd6A1 e6fd6B1 | |||
| 6HGP | Predicted | e6hgpA1 e6hgpB1 | |||
| 6HGQ | Predicted | e6hgqA1 e6hgqC1 e6hgqD1 e6hgqB1 | |||
| 6HGR | Predicted | e6hgrA1 e6hgrB1 | |||
| 6HGS | Predicted | e6hgsA1 e6hgsB1 |