DB04579 N-{[(2S,3S)-3-(Ethoxycarbonyl)-2-oxiranyl]carbonyl}-L-threonyl-L-isoleucine
InChI Key: QMPAEYUADYAXIX-XFVKVHEMSA-N
SMILES: CCOC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)CC)C(O)=O
Small molecule PDB accession : 042
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P07858
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P07858 | Download | Predicted | P07858_nD1 | Cysteine proteinases-like | |
| 1CSB | Predicted | e1csb.1 e1csb.2 | |||
| 1GMY | Predicted | e1gmyA1 e1gmyC1 e1gmyB1 | |||
| 1HUC | Predicted | e1huc.1 e1huc.2 | |||
| 1PBH | Predicted | e1pbhA1 | |||
| 2IPP | Predicted | e2ipp.1 | |||
| 2PBH | Predicted | e2pbhA1 | |||
| 3AI8 | Predicted | e3ai8B1 e3ai8A1 | |||
| 3CBJ | Predicted | e3cbjA1 | |||
| 3CBK | Predicted | e3cbkA1 | |||
| 3K9M | Predicted | e3k9mA1 e3k9mB1 | |||
| 3PBH | Predicted | e3pbhA1 | |||
| 5MBL | Predicted | e5mblA1 | |||
| 5MBM | Predicted | e5mbmA1 e5mbmB1 | |||
| 6AY2 | Predicted | e6ay2A1 e6ay2B1 |