DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P07949
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P07949 | Download | Predicted | P07949_nD1 P07949_nD2 P07949_nD3 P07949_nD6 | Immunoglobulin-like beta-sandwich Immunoglobulin-like beta-sandwich Immunoglobulin-like beta-sandwich Protein kinase/SAICAR synthase/ATP-grasp | |
2IVS | Predicted | e2ivsA1 e2ivsB2 | |||
2IVT | Predicted | e2ivtA2 | |||
2IVU | Predicted | e2ivuA2 | |||
2IVV | Predicted | e2ivvA1 | |||
2X2K | Predicted | e2x2kA2 | |||
2X2L | Predicted | e2x2lA2 | |||
2X2M | Predicted | e2x2mB1 e2x2mA1 | |||
2X2U | Predicted | e2x2uA2 e2x2uA4 | |||
4CKI | Predicted | e4ckiA1 | |||
4CKJ | Predicted | e4ckjA1 | |||
4UX8 | Predicted | e4ux8A1 e4ux8B1 e4ux8A3 e4ux8B3 e4ux8A4 e4ux8B2 e4ux8A2 e4ux8B4 | |||
5AMN | Predicted | e5amnA1 | |||
5FM2 | Predicted | e5fm2A1 | |||
5FM3 | Predicted | e5fm3A1 | |||
6FEK | Predicted | e6fekA1 | |||
6GL7 | Predicted | e6gl7F2 e6gl7E3 e6gl7F1 e6gl7E2 e6gl7F3 e6gl7E4 e6gl7F4 e6gl7E1 | |||
6NE7 | Predicted | e6ne7A1 | |||
6NEC | Predicted | e6necA1 e6necC1 | |||
6NJA | Predicted | e6njaA1 |