DB03765 2'-cytidylic acid
InChI Key: YQUAKORMLHPSLZ-XVFCMESISA-N
SMILES: NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1OP(O)(O)=O
Small molecule PDB accession : C2P
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P07998
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P07998 | Download | Predicted | P07998_nD1 | RNase A-like | |
| 1DZA | Predicted | e1dzaA1 e1dzaB1 | |||
| 1E21 | Predicted | e1e21A1 | |||
| 1H8X | Predicted | e1h8xA1 e1h8xB1 | |||
| 1Z7X | Predicted | e1z7xZ1 e1z7xX1 | |||
| 2E0J | Predicted | e2e0jA1 e2e0jB1 | |||
| 2E0L | Predicted | e2e0lA1 e2e0lB1 | |||
| 2E0M | Predicted | e2e0mA1 e2e0mB1 | |||
| 2E0O | Predicted | e2e0oA1 e2e0oB1 | |||
| 2K11 | Predicted | e2k11A1 | |||
| 2Q4G | Predicted | e2q4gZ1 e2q4gX1 | |||
| 3F8G | Predicted | e3f8gA1 e3f8gB1 | |||
| 4KXH | Predicted | e4kxhA1 e4kxhB1 e4kxhC1 e4kxhD1 |