DB13943 Testosterone cypionate
InChI Key: HPFVBGJFAYZEBE-ZLQWOROUSA-N
SMILES: [H][C@@]12CC[C@H](OC(=O)CCC3CCCC3)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P08235
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P08235 | Download | Predicted | P08235_nD1 P08235_nD2 | Glucocorticoid receptor-like Nuclear receptor ligand-binding domain | |
1Y9R | Predicted | e1y9rA1 e1y9rB1 | |||
1YA3 | Predicted | e1ya3A1 e1ya3C1 e1ya3B1 | |||
2A3I | Predicted | e2a3iA1 | |||
2AA2 | Predicted | e2aa2A1 | |||
2AA5 | Predicted | e2aa5A1 e2aa5B1 | |||
2AA6 | Predicted | e2aa6A1 e2aa6B1 | |||
2AA7 | Predicted | e2aa7A1 | |||
2AAX | Predicted | e2aaxB1 e2aaxA1 | |||
2AB2 | Predicted | e2ab2A1 e2ab2B1 | |||
2ABI | Predicted | e2abiA1 e2abiB1 e2abiC1 | |||
2OAX | Predicted | e2oaxB1 e2oaxE1 e2oaxA1 e2oaxC1 e2oaxD1 e2oaxF1 | |||
3VHU | Predicted | e3vhuA1 | |||
3VHV | Predicted | e3vhvA1 | |||
3WFF | Predicted | e3wffA1 | |||
3WFG | Predicted | e3wfgA1 | |||
4PF3 | Predicted | e4pf3A1 | |||
4TNT | Predicted | e4tntA1 e4tntB1 | |||
4UDA | Predicted | e4udaA1 | |||
4UDB | Predicted | e4udbA1 | |||
5HCV | Predicted | e5hcvA1 e5hcvB1 e5hcvC1 | |||
5L7E | Predicted | e5l7eA1 | |||
5L7G | Predicted | e5l7gA1 | |||
5L7H | Predicted | e5l7hA1 | |||
5MWP | Predicted | e5mwpA1 | |||
5MWY | Predicted | e5mwyA1 | |||
6GEV | Predicted | e6gevA1 | |||
6GG8 | Predicted | e6gg8A1 | |||
6GGG | Predicted | e6gggA1 |