DB02341 Mdl 101,146
InChI Key: XQAMVCHQGHAELT-YPAWHYETSA-N
SMILES: CC(C)[C@@H](NC(=O)C1=CC=C(C=C1)C(=O)N1CCOCC1)C(=O)N1CCC[C@@H]1C(=O)N[C@H](C(C)C)C(=O)C(F)(F)C(F)(F)F
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P08246
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P08246 | Download | Predicted | P08246_nD1 | cradle loop barrel | |
1B0F | Predicted | e1b0fA1 | |||
1H1B | Predicted | e1h1bA1 e1h1bB1 | |||
1HNE | Predicted | e1hneE1 | |||
1PPF | Predicted | e1ppfE1 | |||
1PPG | Predicted | e1ppgE1 | |||
2RG3 | Predicted | e2rg3A1 | |||
2Z7F | Predicted | e2z7fE1 | |||
3Q76 | Predicted | e3q76A1 e3q76B1 | |||
3Q77 | Predicted | e3q77A1 | |||
4NZL | Predicted | e4nzlA1 | |||
4WVP | Predicted | e4wvpE1 | |||
5A09 | Predicted | e5a09A1 | |||
5A0A | Predicted | e5a0aE1 | |||
5A0B | Predicted | e5a0bA1 | |||
5A0C | Predicted | e5a0cA1 e5a0cB1 | |||
5A8X | Predicted | e5a8xA1 | |||
5A8Y | Predicted | e5a8yA1 | |||
5A8Z | Predicted | e5a8zA1 | |||
5ABW | Predicted | e5abwA1 | |||
6E69 | Predicted | e6e69A1 e6e69B1 e6e69C1 e6e69D1 | |||
6F5M | Predicted | e6f5mA1 e6f5mB1 |