DB15588 Ursolic acid
InChI Key: WCGUUGGRBIKTOS-GPOJBZKASA-N
SMILES: [H][C@@]12[C@@H](C)[C@H](C)CC[C@@]1(CC[C@]1(C)C2=CC[C@]2([H])[C@@]3(C)CC[C@H](O)C(C)(C)[C@]3([H])CC[C@@]12C)C(O)=O
Small molecule PDB accession : 6Q5
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P08246
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P08246 | Download | Predicted | P08246_nD1 | cradle loop barrel | |
| 1B0F | Predicted | e1b0fA1 | |||
| 1H1B | Predicted | e1h1bA1 e1h1bB1 | |||
| 1HNE | Predicted | e1hneE1 | |||
| 1PPF | Predicted | e1ppfE1 | |||
| 1PPG | Predicted | e1ppgE1 | |||
| 2RG3 | Predicted | e2rg3A1 | |||
| 2Z7F | Predicted | e2z7fE1 | |||
| 3Q76 | Predicted | e3q76A1 e3q76B1 | |||
| 3Q77 | Predicted | e3q77A1 | |||
| 4NZL | Predicted | e4nzlA1 | |||
| 4WVP | Predicted | e4wvpE1 | |||
| 5A09 | Predicted | e5a09A1 | |||
| 5A0A | Predicted | e5a0aE1 | |||
| 5A0B | Predicted | e5a0bA1 | |||
| 5A0C | Predicted | e5a0cA1 e5a0cB1 | |||
| 5A8X | Predicted | e5a8xA1 | |||
| 5A8Y | Predicted | e5a8yA1 | |||
| 5A8Z | Predicted | e5a8zA1 | |||
| 5ABW | Predicted | e5abwA1 | |||
| 6E69 | Predicted | e6e69A1 e6e69B1 e6e69C1 e6e69D1 | |||
| 6F5M | Predicted | e6f5mA1 e6f5mB1 |