DB08626 Thiorphan
InChI Key: LJJKNPQAGWVLDQ-SNVBAGLBSA-N
SMILES: [H][C@](CS)(CC1=CC=CC=C1)C(=O)NCC(O)=O
Small molecule PDB accession : TIO
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P08473
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P08473 | Download | Predicted | P08473_nD1 | Zincin-like | |
1DMT | Predicted | e1dmtA1 | |||
1R1H | Predicted | e1r1hA1 | |||
1R1I | Predicted | e1r1iA1 | |||
1R1J | Predicted | e1r1jA1 | |||
1Y8J | Predicted | e1y8jA1 | |||
2QPJ | Predicted | e2qpjA1 | |||
2YB9 | Predicted | e2yb9A1 | |||
4CTH | Predicted | e4cthA1 | |||
5JMY | Predicted | e5jmyA1 e5jmyB1 | |||
6GID | Predicted | e6gidA1 | |||
6SH1 | Predicted | e6sh1AAA1 e6sh1CCC1 | |||
6SH2 | Predicted | e6sh2AAA1 |