DB11638 Artenimol
InChI Key: BJDCWCLMFKKGEE-HVDUHBCDSA-N
SMILES: [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4
Small molecule PDB accession : n/a
Drug action: ligand
List of PDB structures and/or AlphaFold models with target protein P08670
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P08670 | Download | Predicted | P08670_nD1 P08670_nD2 | Mitoribosomal protein mS26 Mitoribosomal protein mS26 | |
| 1GK4 | Predicted | ||||
| 1GK6 | Predicted | ||||
| 1GK7 | Predicted | ||||
| 3G1E | Predicted | ||||
| 3KLT | Predicted | ||||
| 3S4R | Predicted | ||||
| 3SSU | Predicted | ||||
| 3SWK | Predicted | ||||
| 3TRT | Predicted | ||||
| 3UF1 | Predicted | ||||
| 4MCY | Predicted | ||||
| 4MCZ | Predicted | ||||
| 4MD0 | Predicted | ||||
| 4MD5 | Predicted | ||||
| 4MDI | Predicted | ||||
| 4MDJ | Predicted | ||||
| 4YPC | Predicted | ||||
| 4YV3 | Predicted | ||||
| 5WHF | Predicted | ||||
| 6ATF | Predicted | ||||
| 6ATI | Predicted | ||||
| 6BIR | Predicted | ||||
| 6YXK | Predicted |