DB06634 Casopitant
InChI Key: XGGTZCKQRWXCHW-WMTVXVAQSA-N
SMILES: C[C@@H](N(C)C(=O)N1CC[C@@H](C[C@@H]1C1=CC=C(F)C=C1C)N1CCN(CC1)C(C)=O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P08684
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P08684 | Download | Predicted | P08684_nD1 | Cytochrome P450 | |
1TQN | Predicted | e1tqnA1 | |||
1W0E | Predicted | e1w0eA1 | |||
1W0F | Predicted | e1w0fA1 | |||
1W0G | Predicted | e1w0gA1 | |||
2J0D | Predicted | e2j0dA1 e2j0dB1 | |||
2V0M | Predicted | e2v0mD1 e2v0mB1 e2v0mA1 e2v0mC1 | |||
3NXU | Predicted | e3nxuA1 e3nxuB1 | |||
3TJS | Predicted | e3tjsA1 | |||
3UA1 | Predicted | e3ua1A1 | |||
4D6Z | Predicted | e4d6zA1 | |||
4D75 | Predicted | e4d75A1 | |||
4D78 | Predicted | e4d78A1 | |||
4D7D | Predicted | e4d7dA1 | |||
4I3Q | Predicted | e4i3qA1 | |||
4I4G | Predicted | e4i4gA1 | |||
4I4H | Predicted | e4i4hA1 | |||
4K9T | Predicted | e4k9tA1 | |||
4K9U | Predicted | e4k9uA1 | |||
4K9V | Predicted | e4k9vA1 | |||
4K9W | Predicted | e4k9wC1 e4k9wD1 e4k9wB1 e4k9wA1 | |||
4K9X | Predicted | e4k9xA1 | |||
4NY4 | Predicted | e4ny4A1 | |||
5A1P | Predicted | e5a1pA1 | |||
5A1R | Predicted | e5a1rA1 | |||
5G5J | Predicted | e5g5jA1 | |||
5TE8 | Predicted | e5te8A1 e5te8B1 e5te8C1 | |||
5VC0 | Predicted | e5vc0A1 | |||
5VCC | Predicted | e5vccA1 | |||
5VCD | Predicted | e5vcdA1 | |||
5VCE | Predicted | e5vceA1 | |||
5VCG | Predicted | e5vcgA1 | |||
6BCZ | Predicted | e6bczA1 | |||
6BD5 | Predicted | e6bd5A1 | |||
6BD6 | Predicted | e6bd6A1 | |||
6BD7 | Predicted | e6bd7A1 | |||
6BD8 | Predicted | e6bd8A1 | |||
6BDH | Predicted | e6bdhA1 | |||
6BDI | Predicted | e6bdiA1 | |||
6BDK | Predicted | e6bdkA1 | |||
6BDM | Predicted | e6bdmA1 | |||
6OO9 | Predicted | e6oo9A1 | |||
6OOA | Predicted | e6ooaA1 | |||
6OOB | Predicted | e6oobA1 |