DB00686 Pentosan polysulfate
InChI Key: FCCNSUIJIOOXEZ-SJYYZXOBSA-N
SMILES: O[C@@H]1CO[C@@H](O[C@@H]2CO[C@@H](O)[C@H](OS(O)(=O)=O)[C@H]2OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O
Small molecule PDB accession : n/a
Drug action: antagonist
List of PDB structures and/or AlphaFold models with target protein P09038
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P09038 | Download | Predicted | P09038_nD1 | beta-Trefoil | |
1BAS | Predicted | e1basA1 | |||
1BFB | Predicted | e1bfbA1 | |||
1BFC | Predicted | e1bfcA1 | |||
1BFF | Predicted | e1bffA1 | |||
1BFG | Predicted | e1bfgA1 | |||
1BLA | Predicted | e1blaA1 | |||
1BLD | Predicted | e1bldA1 | |||
1CVS | Predicted | e1cvsB1 e1cvsA1 | |||
1EV2 | Predicted | e1ev2D1 e1ev2B1 e1ev2C1 e1ev2A1 | |||
1FGA | Predicted | e1fgaA1 | |||
1FQ9 | Predicted | e1fq9B1 e1fq9A1 | |||
1II4 | Predicted | e1ii4A1 e1ii4D1 e1ii4B1 e1ii4C1 | |||
1IIL | Predicted | e1iilB1 e1iilD1 e1iilC1 e1iilA1 | |||
2BFH | Predicted | e2bfhA1 | |||
2FGF | Predicted | e2fgfA1 | |||
2M49 | Predicted | e2m49A1 e2m49C1 | |||
4FGF | Predicted | e4fgfA1 | |||
4OEE | Predicted | e4oeeA1 | |||
4OEF | Predicted | e4oefA1 | |||
4OEG | Predicted | e4oegA1 | |||
5X1O | Predicted | e5x1oA1 e5x1oB1 |