DB01050 Ibuprofen
InChI Key: HEFNNWSXXWATRW-UHFFFAOYSA-N
SMILES: CC(C)CC1=CC=C(C=C1)C(C)C(O)=O
Small molecule PDB accession : n/a
Drug action: modulator
List of PDB structures and/or AlphaFold models with target protein P10415
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P10415 | Download | Predicted | P10415_nD1 | Toxins' membrane translocation domains | |
1G5M | Predicted | e1g5mA1 | |||
1GJH | Predicted | e1gjhA1 | |||
1YSW | Predicted | e1yswA1 | |||
2O21 | Predicted | e2o21A1 | |||
2O22 | Predicted | e2o22A1 | |||
2O2F | Predicted | e2o2fA1 | |||
2W3L | Predicted | e2w3lA1 e2w3lB1 | |||
2XA0 | Predicted | e2xa0A1 e2xa0B1 | |||
4AQ3 | Predicted | e4aq3A2 e4aq3B2 e4aq3C2 | |||
4IEH | Predicted | e4iehA1 | |||
4LVT | Predicted | e4lvtA1 e4lvtB1 | |||
4LXD | Predicted | e4lxdA1 | |||
4MAN | Predicted | e4manA1 e4manB1 | |||
5AGW | Predicted | e5agwA1 e5agwB1 | |||
5AGX | Predicted | e5agxB1 | |||
5FCG | Predicted | e5fcgA1 | |||
5JSN | Predicted | e5jsnA1 e5jsnC1 | |||
5VAU | Predicted | e5vauB1 e5vauC1 e5vauD1 e5vauA1 | |||
5VAX | Predicted | e5vaxA1 e5vaxB1 e5vaxC1 e5vaxD1 | |||
5VAY | Predicted | e5vayD1 | |||
6IWB | Predicted | e6iwbB1 e6iwbD1 | |||
6O0O | Predicted | e6o0oA1 e6o0oC1 |