DB05913 OSI-930
InChI Key: FGTCROZDHDSNIO-UHFFFAOYSA-N
SMILES: FC(F)(F)OC1=CC=C(NC(=O)C2=C(NCC3=CC=NC4=CC=CC=C34)C=CS2)C=C1
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P10721
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P10721 | Download | Predicted | P10721_nD6 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 1PKG | Predicted | e1pkgA1 e1pkgB1 | |||
| 1T45 | Predicted | e1t45A1 | |||
| 1T46 | Predicted | e1t46A1 | |||
| 2E9W | Predicted | e2e9wB10 e2e9wA9 e2e9wB12 e2e9wA11 e2e9wB13 e2e9wA12 e2e9wB11 e2e9wA10 e2e9wB9 e2e9wA8 | |||
| 2EC8 | Predicted | e2ec8A4 e2ec8A3 e2ec8A5 e2ec8A1 e2ec8A2 | |||
| 3G0E | Predicted | e3g0eA1 | |||
| 3G0F | Predicted | e3g0fA1 e3g0fB1 | |||
| 4HVS | Predicted | e4hvsA1 | |||
| 4K94 | Predicted | e4k94C2 e4k94C1 | |||
| 4K9E | Predicted | e4k9eC1 e4k9eC2 | |||
| 4PGZ | Predicted | e4pgzC2 e4pgzB2 e4pgzA1 e4pgzC1 e4pgzB1 e4pgzA2 | |||
| 4U0I | Predicted | e4u0iA1 | |||
| 6GQJ | Predicted | e6gqjA1 e6gqjB1 | |||
| 6GQK | Predicted | e6gqkA1 e6gqkB1 | |||
| 6GQL | Predicted | e6gqlA1 e6gqlB1 | |||
| 6GQM | Predicted | e6gqmA1 e6gqmB1 | |||
| 6HH1 | Predicted | e6hh1A1 | |||
| 6ITT | Predicted | e6ittA1 e6ittB1 | |||
| 6ITV | Predicted | e6itvA1 | |||
| 6KLA | Predicted | e6klaA1 | |||
| 6MOB | Predicted | e6mobA1 |