DB12147 Erdafitinib
InChI Key: OLAHOMJCDNXHFI-UHFFFAOYSA-N
SMILES: COC1=CC(=CC(OC)=C1)N(CCNC(C)C)C1=CC=C2N=CC(=NC2=C1)C1=CN(C)N=C1
Small molecule PDB accession : 5SF
Drug action: substrate
List of PDB structures and/or AlphaFold models with target protein P10721
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P10721 | Download | Predicted | P10721_nD6 | Protein kinase/SAICAR synthase/ATP-grasp | |
1PKG | Predicted | e1pkgA1 e1pkgB1 | |||
1T45 | Predicted | e1t45A1 | |||
1T46 | Predicted | e1t46A1 | |||
2E9W | Predicted | e2e9wB10 e2e9wA9 e2e9wB12 e2e9wA11 e2e9wB13 e2e9wA12 e2e9wB11 e2e9wA10 e2e9wB9 e2e9wA8 | |||
2EC8 | Predicted | e2ec8A4 e2ec8A3 e2ec8A5 e2ec8A1 e2ec8A2 | |||
3G0E | Predicted | e3g0eA1 | |||
3G0F | Predicted | e3g0fA1 e3g0fB1 | |||
4HVS | Predicted | e4hvsA1 | |||
4K94 | Predicted | e4k94C2 e4k94C1 | |||
4K9E | Predicted | e4k9eC1 e4k9eC2 | |||
4PGZ | Predicted | e4pgzC2 e4pgzB2 e4pgzA1 e4pgzC1 e4pgzB1 e4pgzA2 | |||
4U0I | Predicted | e4u0iA1 | |||
6GQJ | Predicted | e6gqjA1 e6gqjB1 | |||
6GQK | Predicted | e6gqkA1 e6gqkB1 | |||
6GQL | Predicted | e6gqlA1 e6gqlB1 | |||
6GQM | Predicted | e6gqmA1 e6gqmB1 | |||
6HH1 | Predicted | e6hh1A1 | |||
6ITT | Predicted | e6ittA1 e6ittB1 | |||
6ITV | Predicted | e6itvA1 | |||
6KLA | Predicted | e6klaA1 | |||
6MOB | Predicted | e6mobA1 |