DB11672 Curcumin
InChI Key: VFLDPWHFBUODDF-FCXRPNKRSA-N
SMILES: COC1=CC(\C=C\C(=O)CC(=O)\C=C\C2=CC(OC)=C(O)C=C2)=CC=C1O
Small molecule PDB accession : CC9
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P11473
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P11473 | Download | Predicted | P11473_nD2 P11473_nD1 | Nuclear receptor ligand-binding domain Glucocorticoid receptor-like | |
1DB1 | Predicted | e1db1A1 | |||
1IE8 | Predicted | e1ie8A1 | |||
1IE9 | Predicted | e1ie9A1 | |||
1KB2 | Predicted | e1kb2A1 e1kb2B1 | |||
1KB4 | Predicted | e1kb4A1 e1kb4B1 | |||
1KB6 | Predicted | e1kb6B1 e1kb6A1 | |||
1S0Z | Predicted | e1s0zA1 | |||
1S19 | Predicted | e1s19A1 | |||
1TXI | Predicted | e1txiA1 | |||
1YNW | Predicted | e1ynwA1 | |||
2HAM | Predicted | e2hamA1 | |||
2HAR | Predicted | e2harA1 | |||
2HAS | Predicted | e2hasA1 | |||
2HB7 | Predicted | e2hb7A1 | |||
2HB8 | Predicted | e2hb8A1 | |||
3A2I | Predicted | e3a2iA1 | |||
3A2J | Predicted | e3a2jA1 | |||
3A3Z | Predicted | e3a3zX1 | |||
3A40 | Predicted | e3a40X1 | |||
3A78 | Predicted | e3a78A1 | |||
3AUQ | Predicted | e3auqA1 | |||
3AUR | Predicted | e3aurA1 | |||
3AX8 | Predicted | e3ax8A1 | |||
3AZ1 | Predicted | e3az1A1 | |||
3AZ2 | Predicted | e3az2A1 | |||
3AZ3 | Predicted | e3az3A1 | |||
3B0T | Predicted | e3b0tA1 | |||
3CS4 | Predicted | e3cs4A1 | |||
3CS6 | Predicted | e3cs6A1 | |||
3KPZ | Predicted | e3kpzA1 | |||
3M7R | Predicted | e3m7rA1 | |||
3OGT | Predicted | e3ogtA1 | |||
3P8X | Predicted | e3p8xA1 | |||
3TKC | Predicted | e3tkcA1 | |||
3VHW | Predicted | e3vhwA1 | |||
3W0A | Predicted | e3w0aA1 | |||
3W0C | Predicted | e3w0cA1 | |||
3W0Y | Predicted | e3w0yA1 | |||
3WGP | Predicted | e3wgpA1 | |||
3WWR | Predicted | e3wwrA1 | |||
3X31 | Predicted | e3x31A1 | |||
3X36 | Predicted | e3x36A1 | |||
4G2I | Predicted | e4g2iA1 | |||
4ITE | Predicted | e4iteA1 | |||
4ITF | Predicted | e4itfA1 | |||
5GT4 | Predicted | e5gt4A1 | |||
5V39 | Predicted | e5v39A1 | |||
5YSY | Predicted | e5ysyA1 | |||
5YT2 | Predicted | e5yt2A1 |