DB02733 Purvalanol
InChI Key: ZKDXRFMOHZVXSG-HNNXBMFYSA-N
SMILES: [H][C@@](CO)(NC1=NC2=C(N=CN2C(C)C)C(NC2=CC=C(C(O)=O)C(Cl)=C2)=N1)C(C)C
Small molecule PDB accession : PVB
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P11802
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P11802 | Download | Predicted | P11802_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 2W96 | Predicted | e2w96B1 | |||
| 2W99 | Predicted | e2w99B1 | |||
| 2W9F | Predicted | e2w9fB1 | |||
| 2W9Z | Predicted | e2w9zB1 | |||
| 3G33 | Predicted | e3g33A1 e3g33C1 | |||
| 5FWK | Predicted | e5fwkK1 | |||
| 5FWL | Predicted | e5fwlK1 | |||
| 5FWM | Predicted | e5fwmK1 | |||
| 5FWP | Predicted | e5fwpK1 | |||
| 6P8E | Predicted | e6p8eB1 | |||
| 6P8F | Predicted | e6p8fB1 | |||
| 6P8G | Predicted | e6p8gB1 | |||
| 6P8H | Predicted | e6p8hB1 |