DB13951 Stanolone acetate
InChI Key: ILCTUFVQFCIIDS-NGFSFWIMSA-N
SMILES: [H][C@@]12CC[C@H](OC(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P14061
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P14061 | Download | Predicted | P14061_nD1 | Rossmann-like | |
| 1A27 | Predicted | e1a27A1 | |||
| 1BHS | Predicted | e1bhsA1 | |||
| 1DHT | Predicted | e1dhtA1 | |||
| 1EQU | Predicted | e1equB1 e1equA1 | |||
| 1FDS | Predicted | e1fdsA1 | |||
| 1FDT | Predicted | e1fdtA1 | |||
| 1FDU | Predicted | e1fduB1 e1fduD1 e1fduA1 e1fduC1 | |||
| 1FDV | Predicted | e1fdvD1 e1fdvA1 e1fdvC1 e1fdvB1 | |||
| 1FDW | Predicted | e1fdwA1 | |||
| 1I5R | Predicted | e1i5rA1 | |||
| 1IOL | Predicted | e1iolA1 | |||
| 1JTV | Predicted | e1jtvA1 | |||
| 1QYV | Predicted | e1qyvA1 | |||
| 1QYW | Predicted | e1qywA1 | |||
| 1QYX | Predicted | e1qyxA1 | |||
| 3DEY | Predicted | e3deyX1 | |||
| 3DHE | Predicted | e3dheA1 | |||
| 3HB4 | Predicted | e3hb4X1 | |||
| 3HB5 | Predicted | e3hb5X1 | |||
| 3KLM | Predicted | e3klmX1 | |||
| 3KLP | Predicted | e3klpX1 | |||
| 3KM0 | Predicted | e3km0B1 e3km0A1 | |||
| 6CGC | Predicted | e6cgcA1 e6cgcB1 | |||
| 6CGE | Predicted | e6cgeA1 e6cgeB1 | |||
| 6DTP | Predicted | e6dtpA1 e6dtpB1 | |||
| 6MNC | Predicted | e6mncA1 e6mncB1 | |||
| 6MNE | Predicted | e6mneA1 e6mneB1 |